C17H22O5 — CID 135027244
methyl (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-methyl-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 135027244) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-methyl-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-methyl-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 135027244 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | methyl (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-methyl-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@H]1C[C@@H](C)O[C@@H](c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C17H22O5/c1-12-11-15(5-4-6-16(18)20-3)22-17(21-12)13-7-9-14(19-2)10-8-13/h4,6-10,12,15,17H,5,11H2,1-3H3/b6-4+/t12-,15-,17-/m1/s1 |
| InChIKey | QKOZLOLERWBPTO-ONHMEJSNSA-N |
| XLogP | 3.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|