C23H26O4 — CID 101410967
(E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-en-1-ol (PubChem CID 101410967) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-en-1-ol.
| Compound Name | (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 101410967 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (E)-4-[(2R,4R,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-en-1-ol |
| SMILES | COc1ccc([C@@H]2O[C@H](C/C=C/CO)C[C@H](/C=C/c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H26O4/c1-25-20-14-11-19(12-15-20)23-26-21(9-5-6-16-24)17-22(27-23)13-10-18-7-3-2-4-8-18/h2-8,10-15,21-24H,9,16-17H2,1H3/b6-5+,13-10+/t21-,22+,23-/m1/s1 |
| InChIKey | NWWPKLMIBKYRFB-NJCYEMBNSA-N |
| XLogP | 4.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|