C26H30O5 — CID 11961393
ethyl (E)-4-[(2R,4R,5R,6S)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 11961393) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is ethyl (E)-4-[(2R,4R,5R,6S)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[(2R,4R,5R,6S)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 11961393 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl (E)-4-[(2R,4R,5R,6S)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H]1O[C@@H](c2ccc(OC)cc2)O[C@@H](/C=C/c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C26H30O5/c1-4-29-25(27)12-8-11-23-19(2)24(18-13-20-9-6-5-7-10-20)31-26(30-23)21-14-16-22(28-3)17-15-21/h5-10,12-19,23-24,26H,4,11H2,1-3H3/b12-8+,18-13+/t19-,23-,24+,26-/m1/s1 |
| InChIKey | FIPXIYWRLNCSHP-SPAMLZNASA-N |
| XLogP | 5.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|