C27H25NO4S — CID 11590704
ethyl (3S,4S)-1-(4-methoxyphenyl)-2-oxo-4-[(E)-2-phenylethenyl]-3-phenylsulfanylazetidine-3-carboxylate (PubChem CID 11590704) has the molecular formula C27H25NO4S and a molecular weight of 459.57 g/mol. Its IUPAC name is ethyl (3S,4S)-1-(4-methoxyphenyl)-2-oxo-4-[(E)-2-phenylethenyl]-3-phenylsulfanylazetidine-3-carboxylate.
| Compound Name | ethyl (3S,4S)-1-(4-methoxyphenyl)-2-oxo-4-[(E)-2-phenylethenyl]-3-phenylsulfanylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11590704 |
| Molecular Formula | C27H25NO4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl (3S,4S)-1-(4-methoxyphenyl)-2-oxo-4-[(E)-2-phenylethenyl]-3-phenylsulfanylazetidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Sc2ccccc2)C(=O)N(c2ccc(OC)cc2)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C27H25NO4S/c1-3-32-26(30)27(33-23-12-8-5-9-13-23)24(19-14-20-10-6-4-7-11-20)28(25(27)29)21-15-17-22(31-2)18-16-21/h4-19,24H,3H2,1-2H3/b19-14+/t24-,27-/m0/s1 |
| InChIKey | RSJCKDIAZNRJOC-QBYWRRCHSA-N |
| XLogP | 5.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|