C26H25NO4S — CID 24970409
methyl 2-[1-(4-methoxyphenyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl]propanoate (PubChem CID 24970409) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is methyl 2-[1-(4-methoxyphenyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl]propanoate.
| Compound Name | methyl 2-[1-(4-methoxyphenyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl]propanoate |
|---|---|
| PubChem CID | 24970409 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | methyl 2-[1-(4-methoxyphenyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl]propanoate |
| SMILES | COC(=O)C(C)C1(Sc2ccccc2)C(=O)N(c2ccc(OC)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C26H25NO4S/c1-18(24(28)31-3)26(32-22-12-8-5-9-13-22)23(19-10-6-4-7-11-19)27(25(26)29)20-14-16-21(30-2)17-15-20/h4-18,23H,1-3H3 |
| InChIKey | FVCDJONTBDEKQS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |