C29H25NO2S2 — CID 10576809
(3S,4R)-4-[bis(phenylsulfanyl)methyl]-1-(4-methoxyphenyl)-3-phenylazetidin-2-one (PubChem CID 10576809) has the molecular formula C29H25NO2S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is (3S,4R)-4-[bis(phenylsulfanyl)methyl]-1-(4-methoxyphenyl)-3-phenylazetidin-2-one.
| Compound Name | (3S,4R)-4-[bis(phenylsulfanyl)methyl]-1-(4-methoxyphenyl)-3-phenylazetidin-2-one |
|---|---|
| PubChem CID | 10576809 |
| Molecular Formula | C29H25NO2S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (3S,4R)-4-[bis(phenylsulfanyl)methyl]-1-(4-methoxyphenyl)-3-phenylazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](c3ccccc3)[C@@H]2C(Sc2ccccc2)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO2S2/c1-32-23-19-17-22(18-20-23)30-27(26(28(30)31)21-11-5-2-6-12-21)29(33-24-13-7-3-8-14-24)34-25-15-9-4-10-16-25/h2-20,26-27,29H,1H3/t26-,27+/m0/s1 |
| InChIKey | LKALFLSKWQDNNF-RRPNLBNLSA-N |
| XLogP | 7.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|