C23H21NO5S — CID 11502727
ethyl (2S,3S)-2-(furan-2-yl)-1-(4-methoxyphenyl)-4-oxo-3-phenylsulfanylazetidine-3-carboxylate (PubChem CID 11502727) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl (2S,3S)-2-(furan-2-yl)-1-(4-methoxyphenyl)-4-oxo-3-phenylsulfanylazetidine-3-carboxylate.
| Compound Name | ethyl (2S,3S)-2-(furan-2-yl)-1-(4-methoxyphenyl)-4-oxo-3-phenylsulfanylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11502727 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | ethyl (2S,3S)-2-(furan-2-yl)-1-(4-methoxyphenyl)-4-oxo-3-phenylsulfanylazetidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Sc2ccccc2)C(=O)N(c2ccc(OC)cc2)[C@H]1c1ccco1 |
| InChI | InChI=1S/C23H21NO5S/c1-3-28-22(26)23(30-18-8-5-4-6-9-18)20(19-10-7-15-29-19)24(21(23)25)16-11-13-17(27-2)14-12-16/h4-15,20H,3H2,1-2H3/t20-,23-/m0/s1 |
| InChIKey | WQHANUCYBXFUAE-REWPJTCUSA-N |
| XLogP | 4.47 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|