C25H23NO3S — CID 11538952
ethyl (3S,4S)-1-benzyl-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate (PubChem CID 11538952) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is ethyl (3S,4S)-1-benzyl-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate.
| Compound Name | ethyl (3S,4S)-1-benzyl-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11538952 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | ethyl (3S,4S)-1-benzyl-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Sc2ccccc2)C(=O)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23NO3S/c1-2-29-24(28)25(30-21-16-10-5-11-17-21)22(20-14-8-4-9-15-20)26(23(25)27)18-19-12-6-3-7-13-19/h3-17,22H,2,18H2,1H3/t22-,25-/m0/s1 |
| InChIKey | RQVTXWGSFXRRBJ-DHLKQENFSA-N |
| XLogP | 4.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|