C31H33NO4 — CID 15489172
diethyl (3aR,8bS)-4-benzyl-8b-methyl-1-phenyl-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarboxylate (PubChem CID 15489172) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is diethyl (3aR,8bS)-4-benzyl-8b-methyl-1-phenyl-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarboxylate.
| Compound Name | diethyl (3aR,8bS)-4-benzyl-8b-methyl-1-phenyl-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 15489172 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | diethyl (3aR,8bS)-4-benzyl-8b-methyl-1-phenyl-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(c2ccccc2)[C@@]2(C)c3ccccc3N(Cc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C31H33NO4/c1-4-35-28(33)31(29(34)36-5-2)20-25(23-16-10-7-11-17-23)30(3)24-18-12-13-19-26(24)32(27(30)31)21-22-14-8-6-9-15-22/h6-19,25,27H,4-5,20-21H2,1-3H3/t25?,27-,30-/m1/s1 |
| InChIKey | LBUZXUCRBGKLEQ-RHNILLBBSA-N |
| XLogP | 5.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|