C27H29NO4 — CID 11212604
ethyl (1R,2R,10S,11S,13R)-9-benzyl-13-methyl-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate (PubChem CID 11212604) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is ethyl (1R,2R,10S,11S,13R)-9-benzyl-13-methyl-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate.
| Compound Name | ethyl (1R,2R,10S,11S,13R)-9-benzyl-13-methyl-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate |
|---|---|
| PubChem CID | 11212604 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl (1R,2R,10S,11S,13R)-9-benzyl-13-methyl-12-oxo-18-oxa-9-azapentacyclo[9.6.1.01,13.02,10.03,8]octadeca-3,5,7-triene-11-carboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@]3(CCCC[C@@]3(C)C1=O)[C@@H]1c3ccccc3N(Cc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C27H29NO4/c1-3-31-24(30)27-22-21(26(32-27)16-10-9-15-25(26,2)23(27)29)19-13-7-8-14-20(19)28(22)17-18-11-5-4-6-12-18/h4-8,11-14,21-22H,3,9-10,15-17H2,1-2H3/t21-,22+,25+,26-,27+/m1/s1 |
| InChIKey | GKUWNGQFJAGPPO-JQORZIESSA-N |
| XLogP | 4.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|