C20H23NO4 — CID 10831093
ethyl (1R,16S)-15-methyl-18-oxo-17-oxa-11-azapentacyclo[13.2.1.03,16.05,10.011,16]octadeca-5,7,9-triene-1-carboxylate (PubChem CID 10831093) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl (1R,16S)-15-methyl-18-oxo-17-oxa-11-azapentacyclo[13.2.1.03,16.05,10.011,16]octadeca-5,7,9-triene-1-carboxylate.
| Compound Name | ethyl (1R,16S)-15-methyl-18-oxo-17-oxa-11-azapentacyclo[13.2.1.03,16.05,10.011,16]octadeca-5,7,9-triene-1-carboxylate |
|---|---|
| PubChem CID | 10831093 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl (1R,16S)-15-methyl-18-oxo-17-oxa-11-azapentacyclo[13.2.1.03,16.05,10.011,16]octadeca-5,7,9-triene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC3Cc4ccccc4N4CCCC(C)(C1=O)[C@@]34O2 |
| InChI | InChI=1S/C20H23NO4/c1-3-24-17(23)19-12-14-11-13-7-4-5-8-15(13)21-10-6-9-18(2,16(19)22)20(14,21)25-19/h4-5,7-8,14H,3,6,9-12H2,1-2H3/t14?,18?,19-,20+/m1/s1 |
| InChIKey | FMXMILAGBKCZFC-XQDOUHLSSA-N |
| XLogP | 2.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|