C22H23NO6 — CID 101351403
ethyl (1R,2S,10R,17S,18S)-17-ethyl-12,20-dioxo-3,19-dioxa-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate (PubChem CID 101351403) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl (1R,2S,10R,17S,18S)-17-ethyl-12,20-dioxo-3,19-dioxa-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate.
| Compound Name | ethyl (1R,2S,10R,17S,18S)-17-ethyl-12,20-dioxo-3,19-dioxa-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
|---|---|
| PubChem CID | 101351403 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | ethyl (1R,2S,10R,17S,18S)-17-ethyl-12,20-dioxo-3,19-dioxa-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
| SMILES | CCOC(=O)[C@]12O[C@]34N(CCC[C@]3(CC)C1=O)C(=O)C[C@]41c3ccccc3O[C@H]21 |
| InChI | InChI=1S/C22H23NO6/c1-3-19-10-7-11-23-15(24)12-20-13-8-5-6-9-14(13)28-17(20)21(16(19)25,18(26)27-4-2)29-22(19,20)23/h5-6,8-9,17H,3-4,7,10-12H2,1-2H3/t17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | LYSKXFKJCOSFFJ-KMHBYZIFSA-N |
| XLogP | 1.72 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|