C26H30N2O7 — CID 134867257
methyl (2S,10R,17R,18R)-3-methyl-17-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-12,20-dioxo-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate (PubChem CID 134867257) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is methyl (2S,10R,17R,18R)-3-methyl-17-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-12,20-dioxo-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate.
| Compound Name | methyl (2S,10R,17R,18R)-3-methyl-17-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-12,20-dioxo-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
|---|---|
| PubChem CID | 134867257 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | methyl (2S,10R,17R,18R)-3-methyl-17-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-12,20-dioxo-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
| SMILES | COC(=O)C12O[C@@]34N(CCC[C@]3(CC(=O)OC(C)(C)C)C1=O)C(=O)C[C@]41c3ccccc3N(C)[C@H]21 |
| InChI | InChI=1S/C26H30N2O7/c1-22(2,3)34-18(30)14-23-11-8-12-28-17(29)13-24-15-9-6-7-10-16(15)27(4)19(24)25(20(23)31,21(32)33-5)35-26(23,24)28/h6-7,9-10,19H,8,11-14H2,1-5H3/t19-,23-,24+,25?,26-/m0/s1 |
| InChIKey | KRHDYKSWCCVZKF-OJUDNHQSSA-N |
| XLogP | 1.71 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|