C21H28N2O4 — CID 11773166
tert-butyl 1-butyl-2'-ethenyl-2'-hydroxy-4-oxospiro[azetidine-2,3'-indole]-1'-carboxylate (PubChem CID 11773166) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl 1-butyl-2'-ethenyl-2'-hydroxy-4-oxospiro[azetidine-2,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl 1-butyl-2'-ethenyl-2'-hydroxy-4-oxospiro[azetidine-2,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 11773166 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl 1-butyl-2'-ethenyl-2'-hydroxy-4-oxospiro[azetidine-2,3'-indole]-1'-carboxylate |
| SMILES | C=CC1(O)N(C(=O)OC(C)(C)C)c2ccccc2C12CC(=O)N2CCCC |
| InChI | InChI=1S/C21H28N2O4/c1-6-8-13-22-17(24)14-20(22)15-11-9-10-12-16(15)23(21(20,26)7-2)18(25)27-19(3,4)5/h7,9-12,26H,2,6,8,13-14H2,1,3-5H3 |
| InChIKey | XOKVOHZBYSFZNG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|