C18H21NO6 — CID 102501815
tert-butyl 2-oxo-2'-prop-2-enoxyspiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-3-carboxylate (PubChem CID 102501815) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is tert-butyl 2-oxo-2'-prop-2-enoxyspiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-3-carboxylate.
| Compound Name | tert-butyl 2-oxo-2'-prop-2-enoxyspiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-3-carboxylate |
|---|---|
| PubChem CID | 102501815 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | tert-butyl 2-oxo-2'-prop-2-enoxyspiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-3-carboxylate |
| SMILES | C=CCOC1Oc2ccccc2C12COC(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H21NO6/c1-5-10-22-14-18(12-8-6-7-9-13(12)24-14)11-23-15(20)19(18)16(21)25-17(2,3)4/h5-9,14H,1,10-11H2,2-4H3 |
| InChIKey | OSNGLHNHQMWPBM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|