C17H21NO5 — CID 158181918
tert-butyl 2-methyl-2-(2-oxoethyl)-3H-indole-1-carboxylate;carbon dioxide (PubChem CID 158181918) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-(2-oxoethyl)-3H-indole-1-carboxylate;carbon dioxide.
| Compound Name | tert-butyl 2-methyl-2-(2-oxoethyl)-3H-indole-1-carboxylate;carbon dioxide |
|---|---|
| PubChem CID | 158181918 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | tert-butyl 2-methyl-2-(2-oxoethyl)-3H-indole-1-carboxylate;carbon dioxide |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2CC1(C)CC=O.O=C=O |
| InChI | InChI=1S/C16H21NO3.CO2/c1-15(2,3)20-14(19)17-13-8-6-5-7-12(13)11-16(17,4)9-10-18;2-1-3/h5-8,10H,9,11H2,1-4H3; |
| InChIKey | FYRSQASVCRPQEX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|