C15H19NO3 — CID 90005169
tert-butyl 3-formyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 90005169) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl 3-formyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 3-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 90005169 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | tert-butyl 3-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C=O)Cc2ccccc21 |
| InChI | InChI=1S/C15H19NO3/c1-15(2,3)19-14(18)16-9-11(10-17)8-12-6-4-5-7-13(12)16/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | YIVVIKJRQDILFW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|