C29H38N2O5 — CID 135067446
ditert-butyl (1R,10R)-12,12-bis(ethenyl)-9-oxo-8,14-diazatetracyclo[8.7.0.01,13.02,7]heptadeca-2,4,6-triene-8,14-dicarboxylate (PubChem CID 135067446) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is ditert-butyl (1R,10R)-12,12-bis(ethenyl)-9-oxo-8,14-diazatetracyclo[8.7.0.01,13.02,7]heptadeca-2,4,6-triene-8,14-dicarboxylate.
| Compound Name | ditert-butyl (1R,10R)-12,12-bis(ethenyl)-9-oxo-8,14-diazatetracyclo[8.7.0.01,13.02,7]heptadeca-2,4,6-triene-8,14-dicarboxylate |
|---|---|
| PubChem CID | 135067446 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | ditert-butyl (1R,10R)-12,12-bis(ethenyl)-9-oxo-8,14-diazatetracyclo[8.7.0.01,13.02,7]heptadeca-2,4,6-triene-8,14-dicarboxylate |
| SMILES | C=CC1(C=C)C[C@H]2C(=O)N(C(=O)OC(C)(C)C)c3ccccc3[C@@]23CCCN(C(=O)OC(C)(C)C)C13 |
| InChI | InChI=1S/C29H38N2O5/c1-9-28(10-2)18-20-22(32)31(25(34)36-27(6,7)8)21-15-12-11-14-19(21)29(20)16-13-17-30(23(28)29)24(33)35-26(3,4)5/h9-12,14-15,20,23H,1-2,13,16-18H2,3-8H3/t20-,23?,29-/m0/s1 |
| InChIKey | RYMOXAWSBMPEJU-NWEKYVMVSA-N |
| XLogP | 5.98 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|