C48H62I2N4O10 — CID 139114739
methyl (1R,9R,10S,11R,12R,14R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-14-iodo-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-10-carboxylate (PubChem CID 139114739) has the molecular formula C48H62I2N4O10 and a molecular weight of 1108.85 g/mol. Its IUPAC name is methyl (1R,9R,10S,11R,12R,14R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-14-iodo-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-10-carboxylate.
| Compound Name | methyl (1R,9R,10S,11R,12R,14R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-14-iodo-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-10-carboxylate |
|---|---|
| PubChem CID | 139114739 |
| Molecular Formula | C48H62I2N4O10 |
| Molecular Weight | 1108.85 g/mol |
| Exact Mass | 1108.26 |
| IUPAC Name | methyl (1R,9R,10S,11R,12R,14R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-14-iodo-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-10-carboxylate |
| SMILES | CC[C@]12C[C@@H](I)CN3CC[C@@]4(c5ccccc5N(C)[C@H]4[C@@](O)(C(=O)OC)[C@@H]1OC(C)=O)[C@@H]32.CC[C@]12C[C@@H](I)CN3CC[C@@]4(c5ccccc5N(C)[C@H]4[C@@](O)(C(=O)OC)[C@@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/2C24H31IN2O5/c2*1-5-22-12-15(25)13-27-11-10-23(18(22)27)16-8-6-7-9-17(16)26(3)19(23)24(30,21(29)31-4)20(22)32-14(2)28/h2*6-9,15,18-20,30H,5,10-13H2,1-4H3/t2*15-,18+,19-,20-,22-,23-,24+/m11/s1 |
| InChIKey | PBWDOEXJDMWTFO-NAVJWOILSA-N |
| XLogP | 4.54 |
| TPSA | 158.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|