C25H34N2O6 — CID 143060878
methyl (4R,6S)-5-acetyloxy-4-ethyl-6-hydroxy-9-methoxy-7-methyl-4-[(Z)-prop-1-enyl]-1,2,3,3a,5,6a-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 143060878) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is methyl (4R,6S)-5-acetyloxy-4-ethyl-6-hydroxy-9-methoxy-7-methyl-4-[(Z)-prop-1-enyl]-1,2,3,3a,5,6a-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (4R,6S)-5-acetyloxy-4-ethyl-6-hydroxy-9-methoxy-7-methyl-4-[(Z)-prop-1-enyl]-1,2,3,3a,5,6a-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 143060878 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | methyl (4R,6S)-5-acetyloxy-4-ethyl-6-hydroxy-9-methoxy-7-methyl-4-[(Z)-prop-1-enyl]-1,2,3,3a,5,6a-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | C/C=C\[C@]1(CC)C2NCCC23c2ccc(OC)cc2N(C)C3[C@@](O)(C(=O)OC)C1OC(C)=O |
| InChI | InChI=1S/C25H34N2O6/c1-7-11-23(8-2)19-24(12-13-26-19)17-10-9-16(31-5)14-18(17)27(4)20(24)25(30,22(29)32-6)21(23)33-15(3)28/h7,9-11,14,19-21,26,30H,8,12-13H2,1-6H3/b11-7-/t19?,20?,21?,23-,24?,25+/m1/s1 |
| InChIKey | YFGZPVCTKCSCQY-QWHHAWNESA-N |
| XLogP | 1.94 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|