C26H35N3O5 — CID 70928586
[(9R,11R,12R,19R)-12-ethyl-10-(ethylcarbamoyl)-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate (PubChem CID 70928586) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is [(9R,11R,12R,19R)-12-ethyl-10-(ethylcarbamoyl)-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate.
| Compound Name | [(9R,11R,12R,19R)-12-ethyl-10-(ethylcarbamoyl)-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate |
|---|---|
| PubChem CID | 70928586 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | [(9R,11R,12R,19R)-12-ethyl-10-(ethylcarbamoyl)-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate |
| SMILES | CCNC(=O)C1(O)[C@@H]2N(C)c3cc(OC)ccc3C23CCN2CC=C[C@](CC)([C@H]23)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H35N3O5/c1-6-24-11-8-13-29-14-12-25(20(24)29)18-10-9-17(33-5)15-19(18)28(4)21(25)26(32,23(31)27-7-2)22(24)34-16(3)30/h8-11,15,20-22,32H,6-7,12-14H2,1-5H3,(H,27,31)/t20-,21+,22+,24+,25?,26?/m0/s1 |
| InChIKey | NMYQXWFXXUHTFL-WPYVOTSPSA-N |
| XLogP | 1.60 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|