C32H37N3O7 — CID 143728568
[(1R,9R,10S,11R,19R)-10-[(1,3-benzodioxole-5-carbonylamino)methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate (PubChem CID 143728568) has the molecular formula C32H37N3O7 and a molecular weight of 575.66 g/mol. Its IUPAC name is [(1R,9R,10S,11R,19R)-10-[(1,3-benzodioxole-5-carbonylamino)methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate.
| Compound Name | [(1R,9R,10S,11R,19R)-10-[(1,3-benzodioxole-5-carbonylamino)methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate |
|---|---|
| PubChem CID | 143728568 |
| Molecular Formula | C32H37N3O7 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | [(1R,9R,10S,11R,19R)-10-[(1,3-benzodioxole-5-carbonylamino)methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate |
| SMILES | CCC12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(CNC(=O)c4ccc5c(c4)OCO5)[C@@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C32H37N3O7/c1-5-30-11-6-13-35-14-12-31(27(30)35)22-9-8-21(39-4)16-23(22)34(3)28(31)32(38,29(30)42-19(2)36)17-33-26(37)20-7-10-24-25(15-20)41-18-40-24/h6-11,15-16,27-29,38H,5,12-14,17-18H2,1-4H3,(H,33,37)/t27-,28+,29+,30?,31+,32-/m0/s1 |
| InChIKey | VMEPGJBSWDJSMX-PMPMZEGFSA-N |
| XLogP | 2.63 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|