C31H35ClN2O6 — CID 25135801
[(1R,9R,10R,11R,12R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-10-yl]methyl 2-chlorobenzoate (PubChem CID 25135801) has the molecular formula C31H35ClN2O6 and a molecular weight of 567.08 g/mol. Its IUPAC name is [(1R,9R,10R,11R,12R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-10-yl]methyl 2-chlorobenzoate.
| Compound Name | [(1R,9R,10R,11R,12R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-10-yl]methyl 2-chlorobenzoate |
|---|---|
| PubChem CID | 25135801 |
| Molecular Formula | C31H35ClN2O6 |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [(1R,9R,10R,11R,12R,19R)-11-acetyloxy-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-10-yl]methyl 2-chlorobenzoate |
| SMILES | CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(COC(=O)c4ccccc4Cl)[C@@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C31H35ClN2O6/c1-5-29-13-8-15-34-16-14-30(26(29)34)22-12-11-20(38-4)17-24(22)33(3)27(30)31(37,28(29)40-19(2)35)18-39-25(36)21-9-6-7-10-23(21)32/h6-13,17,26-28,37H,5,14-16,18H2,1-4H3/t26-,27+,28+,29+,30+,31-/m0/s1 |
| InChIKey | VBXVJELKTJAYIE-NDJQCSGZSA-N |
| XLogP | 3.98 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|