C31H36ClN3O5 — CID 143728457
[(1R,9R,10S,11R,19R)-10-[[(3-chlorobenzoyl)amino]methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate (PubChem CID 143728457) has the molecular formula C31H36ClN3O5 and a molecular weight of 566.10 g/mol. Its IUPAC name is [(1R,9R,10S,11R,19R)-10-[[(3-chlorobenzoyl)amino]methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate.
| Compound Name | [(1R,9R,10S,11R,19R)-10-[[(3-chlorobenzoyl)amino]methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate |
|---|---|
| PubChem CID | 143728457 |
| Molecular Formula | C31H36ClN3O5 |
| Molecular Weight | 566.10 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | [(1R,9R,10S,11R,19R)-10-[[(3-chlorobenzoyl)amino]methyl]-12-ethyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-yl] acetate |
| SMILES | CCC12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(CNC(=O)c4cccc(Cl)c4)[C@@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C31H36ClN3O5/c1-5-29-12-7-14-35-15-13-30(26(29)35)23-11-10-22(39-4)17-24(23)34(3)27(30)31(38,28(29)40-19(2)36)18-33-25(37)20-8-6-9-21(32)16-20/h6-12,16-17,26-28,38H,5,13-15,18H2,1-4H3,(H,33,37)/t26-,27+,28+,29?,30+,31-/m0/s1 |
| InChIKey | KUEKWAQJAVVDNG-LXYJIFTMSA-N |
| XLogP | 3.55 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|