C25H33N3O5 — CID 143061123
methyl (1R,10S,12R)-11-acetyloxy-10-amino-12-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate (PubChem CID 143061123) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is methyl (1R,10S,12R)-11-acetyloxy-10-amino-12-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate.
| Compound Name | methyl (1R,10S,12R)-11-acetyloxy-10-amino-12-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 143061123 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | methyl (1R,10S,12R)-11-acetyloxy-10-amino-12-ethyl-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate |
| SMILES | CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)C4[C@@](N)(C(=O)OC)C1OC(C)=O)C32 |
| InChI | InChI=1S/C25H33N3O5/c1-6-23-10-7-12-28-13-11-24(19(23)28)17-9-8-16(31-4)14-18(17)27(3)20(24)25(26,22(30)32-5)21(23)33-15(2)29/h7-10,14,19-21H,6,11-13,26H2,1-5H3/t19?,20?,21?,23-,24-,25+/m1/s1 |
| InChIKey | WYKHVYDANWMPNF-LUZSBADVSA-N |
| XLogP | 1.61 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|