C27H36N2O6 — CID 124723333
methyl (1S,9S,10R,11R,12R,19S)-11-acetyloxy-12-butyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate (PubChem CID 124723333) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is methyl (1S,9S,10R,11R,12R,19S)-11-acetyloxy-12-butyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate.
| Compound Name | methyl (1S,9S,10R,11R,12R,19S)-11-acetyloxy-12-butyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 124723333 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | methyl (1S,9S,10R,11R,12R,19S)-11-acetyloxy-12-butyl-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate |
| SMILES | CCCC[C@]12C=CCN3CC[C@]4(c5ccc(OC)cc5N(C)[C@@H]4[C@](O)(C(=O)OC)[C@@H]1OC(C)=O)[C@H]32 |
| InChI | InChI=1S/C27H36N2O6/c1-6-7-11-25-12-8-14-29-15-13-26(21(25)29)19-10-9-18(33-4)16-20(19)28(3)22(26)27(32,24(31)34-5)23(25)35-17(2)30/h8-10,12,16,21-23,32H,6-7,11,13-15H2,1-5H3/t21-,22+,23-,25-,26+,27-/m1/s1 |
| InChIKey | VIYXAYCNUJJQSP-NMYOGCBASA-N |
| XLogP | 2.42 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|