C17H21FO4 — CID 161137630
tert-butyl 2-[(2R,3R)-3-(2-fluorophenyl)-2-formyloxolan-3-yl]acetate (PubChem CID 161137630) has the molecular formula C17H21FO4 and a molecular weight of 308.35 g/mol. Its IUPAC name is tert-butyl 2-[(2R,3R)-3-(2-fluorophenyl)-2-formyloxolan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,3R)-3-(2-fluorophenyl)-2-formyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 161137630 |
| Molecular Formula | C17H21FO4 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | tert-butyl 2-[(2R,3R)-3-(2-fluorophenyl)-2-formyloxolan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@]1(c2ccccc2F)CCO[C@H]1C=O |
| InChI | InChI=1S/C17H21FO4/c1-16(2,3)22-15(20)10-17(8-9-21-14(17)11-19)12-6-4-5-7-13(12)18/h4-7,11,14H,8-10H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | MXTXPWSEEYJZQE-WMLDXEAASA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|