C16H20FNO4 — CID 89095567
tert-butyl N-[(3R)-3-(2-fluorophenyl)-4-formyloxolan-3-yl]carbamate (PubChem CID 89095567) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-(2-fluorophenyl)-4-formyloxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-(2-fluorophenyl)-4-formyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 89095567 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | tert-butyl N-[(3R)-3-(2-fluorophenyl)-4-formyloxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@]1(c2ccccc2F)COCC1C=O |
| InChI | InChI=1S/C16H20FNO4/c1-15(2,3)22-14(20)18-16(10-21-9-11(16)8-19)12-6-4-5-7-13(12)17/h4-8,11H,9-10H2,1-3H3,(H,18,20)/t11?,16-/m1/s1 |
| InChIKey | LZOMDTSKDGNRAV-WVQRXBFSSA-N |
| XLogP | 2.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|