C16H22ClNO4 — CID 139573264
tert-butyl N-[1-(2-chlorophenyl)-2,3-dihydroxycyclopentyl]carbamate (PubChem CID 139573264) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is tert-butyl N-[1-(2-chlorophenyl)-2,3-dihydroxycyclopentyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-chlorophenyl)-2,3-dihydroxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 139573264 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | tert-butyl N-[1-(2-chlorophenyl)-2,3-dihydroxycyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccccc2Cl)CCC(O)C1O |
| InChI | InChI=1S/C16H22ClNO4/c1-15(2,3)22-14(21)18-16(9-8-12(19)13(16)20)10-6-4-5-7-11(10)17/h4-7,12-13,19-20H,8-9H2,1-3H3,(H,18,21) |
| InChIKey | PTFCNTBZACBBQV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |