C24H25ClN2O7 — CID 130471248
[(1S,3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxocyclohexyl] 4-nitrobenzoate (PubChem CID 130471248) has the molecular formula C24H25ClN2O7 and a molecular weight of 488.92 g/mol. Its IUPAC name is [(1S,3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxocyclohexyl] 4-nitrobenzoate.
| Compound Name | [(1S,3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxocyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 130471248 |
| Molecular Formula | C24H25ClN2O7 |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [(1S,3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxocyclohexyl] 4-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(c2ccccc2Cl)CCC[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C24H25ClN2O7/c1-23(2,3)34-22(30)26-24(17-7-4-5-8-18(17)25)14-6-9-19(20(24)28)33-21(29)15-10-12-16(13-11-15)27(31)32/h4-5,7-8,10-13,19H,6,9,14H2,1-3H3,(H,26,30)/t19-,24+/m0/s1 |
| InChIKey | SLHUVNOBHWADTI-YADARESESA-N |
| XLogP | 4.95 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|