C18H21F4NO4 — CID 139573687
tert-butyl N-[1-[2-fluoro-3-(trifluoromethyl)phenyl]-3-hydroxy-2-oxocyclohexyl]carbamate (PubChem CID 139573687) has the molecular formula C18H21F4NO4 and a molecular weight of 391.36 g/mol. Its IUPAC name is tert-butyl N-[1-[2-fluoro-3-(trifluoromethyl)phenyl]-3-hydroxy-2-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-fluoro-3-(trifluoromethyl)phenyl]-3-hydroxy-2-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 139573687 |
| Molecular Formula | C18H21F4NO4 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | tert-butyl N-[1-[2-fluoro-3-(trifluoromethyl)phenyl]-3-hydroxy-2-oxocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cccc(C(F)(F)F)c2F)CCCC(O)C1=O |
| InChI | InChI=1S/C18H21F4NO4/c1-16(2,3)27-15(26)23-17(9-5-8-12(24)14(17)25)10-6-4-7-11(13(10)19)18(20,21)22/h4,6-7,12,24H,5,8-9H2,1-3H3,(H,23,26) |
| InChIKey | LUEQIAOPLFTGAX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |