C18H21FN2O4 — CID 139573283
tert-butyl N-[1-(4-cyano-2-fluorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamate (PubChem CID 139573283) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is tert-butyl N-[1-(4-cyano-2-fluorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-cyano-2-fluorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 139573283 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | tert-butyl N-[1-(4-cyano-2-fluorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(C#N)cc2F)CCCC(O)C1=O |
| InChI | InChI=1S/C18H21FN2O4/c1-17(2,3)25-16(24)21-18(8-4-5-14(22)15(18)23)12-7-6-11(10-20)9-13(12)19/h6-7,9,14,22H,4-5,8H2,1-3H3,(H,21,24) |
| InChIKey | LOZMSLQYNSWWFK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |