C18H22F3NO4 — CID 139573668
tert-butyl N-[3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]cyclohexyl]carbamate (PubChem CID 139573668) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 139573668 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | tert-butyl N-[3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cccc(C(F)(F)F)c2)CCCC(O)C1=O |
| InChI | InChI=1S/C18H22F3NO4/c1-16(2,3)26-15(25)22-17(9-5-8-13(23)14(17)24)11-6-4-7-12(10-11)18(19,20)21/h4,6-7,10,13,23H,5,8-9H2,1-3H3,(H,22,25) |
| InChIKey | RFKSDQMWSAXJQM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |