C13H15ClF3NO2 — CID 139559114
2-amino-6-hydroxy-2-[3-(trifluoromethyl)phenyl]cyclohexan-1-one;hydrochloride (PubChem CID 139559114) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-amino-6-hydroxy-2-[3-(trifluoromethyl)phenyl]cyclohexan-1-one;hydrochloride.
| Compound Name | 2-amino-6-hydroxy-2-[3-(trifluoromethyl)phenyl]cyclohexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 139559114 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-amino-6-hydroxy-2-[3-(trifluoromethyl)phenyl]cyclohexan-1-one;hydrochloride |
| SMILES | Cl.NC1(c2cccc(C(F)(F)F)c2)CCCC(O)C1=O |
| InChI | InChI=1S/C13H14F3NO2.ClH/c14-13(15,16)9-4-1-3-8(7-9)12(17)6-2-5-10(18)11(12)19;/h1,3-4,7,10,18H,2,5-6,17H2;1H |
| InChIKey | LFRSFDSWSKYFRH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |