C13H13ClF3NO3 — CID 139559138
2-amino-2-[3-chloro-5-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one (PubChem CID 139559138) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is 2-amino-2-[3-chloro-5-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one.
| Compound Name | 2-amino-2-[3-chloro-5-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 139559138 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-amino-2-[3-chloro-5-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one |
| SMILES | NC1(c2cc(Cl)cc(OC(F)(F)F)c2)CCCC(O)C1=O |
| InChI | InChI=1S/C13H13ClF3NO3/c14-8-4-7(5-9(6-8)21-13(15,16)17)12(18)3-1-2-10(19)11(12)20/h4-6,10,19H,1-3,18H2 |
| InChIKey | OTWYCIZTEBGQKX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |