C14H14ClF3O3 — CID 161124097
2-[4-chloro-3-(trifluoromethoxy)phenyl]-6-hydroxy-2-methylcyclohexan-1-one (PubChem CID 161124097) has the molecular formula C14H14ClF3O3 and a molecular weight of 322.71 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethoxy)phenyl]-6-hydroxy-2-methylcyclohexan-1-one.
| Compound Name | 2-[4-chloro-3-(trifluoromethoxy)phenyl]-6-hydroxy-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 161124097 |
| Molecular Formula | C14H14ClF3O3 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethoxy)phenyl]-6-hydroxy-2-methylcyclohexan-1-one |
| SMILES | CC1(c2ccc(Cl)c(OC(F)(F)F)c2)CCCC(O)C1=O |
| InChI | InChI=1S/C14H14ClF3O3/c1-13(6-2-3-10(19)12(13)20)8-4-5-9(15)11(7-8)21-14(16,17)18/h4-5,7,10,19H,2-3,6H2,1H3 |
| InChIKey | YNUVVVSTFTXOJP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |