C14H13ClF3NO4 — CID 175467790
[(1R)-1-[4-chloro-3-(trifluoromethoxy)phenyl]-2-oxocyclohexyl] carbamate (PubChem CID 175467790) has the molecular formula C14H13ClF3NO4 and a molecular weight of 351.71 g/mol. Its IUPAC name is [(1R)-1-[4-chloro-3-(trifluoromethoxy)phenyl]-2-oxocyclohexyl] carbamate.
| Compound Name | [(1R)-1-[4-chloro-3-(trifluoromethoxy)phenyl]-2-oxocyclohexyl] carbamate |
|---|---|
| PubChem CID | 175467790 |
| Molecular Formula | C14H13ClF3NO4 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [(1R)-1-[4-chloro-3-(trifluoromethoxy)phenyl]-2-oxocyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@]1(c2ccc(Cl)c(OC(F)(F)F)c2)CCCCC1=O |
| InChI | InChI=1S/C14H13ClF3NO4/c15-9-5-4-8(7-10(9)22-14(16,17)18)13(23-12(19)21)6-2-1-3-11(13)20/h4-5,7H,1-3,6H2,(H2,19,21)/t13-/m1/s1 |
| InChIKey | JLJJRMPPTDTERY-CYBMUJFWSA-N |
| XLogP | 3.67 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |