About 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide
2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide (PubChem CID 135389521) has the molecular formula C20H19ClF3N3O3
and a molecular weight of 441.84 g/mol. Its IUPAC name is 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide |
| PubChem CID | 135389521 |
| Molecular Formula | C20H19ClF3N3O3 |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide |
| SMILES | NC(=O)N1CCCCC1(C(N)=O)c1ccc(-c2ccccc2OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClF3N3O3/c21-15-11-12(19(17(25)28)9-3-4-10-27(19)18(26)29)7-8-13(15)14-5-1-2-6-16(14)30-20(22,23)24/h1-2,5-8,11H,3-4,9-10H2,(H2,25,28)(H2,26,29) |
| InChIKey | LERNFMZQDGJSDO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide?
The IUPAC name of 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide (CID 135389521) is 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide.
What is the SMILES notation for 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide?
The canonical SMILES for 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide is NC(=O)N1CCCCC1(C(N)=O)c1ccc(-c2ccccc2OC(F)(F)F)c(Cl)c1.
What is the InChIKey of 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide?
The InChIKey is LERNFMZQDGJSDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClF3N3O3/c21-15-11-12(19(17(25)28)9-3-4-10-27(19)18(26)29)7-8-13(15)14-5-1-2-6-16(14)30-20(22,23)24/h1-2,5-8,11H,3-4,9-10H2,(H2,25,28)(H2,26,29).
What are the key properties of 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide?
2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide has a molecular weight of 441.84 g/mol, XLogP of 4.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]piperidine-1,2-dicarboxamide is sourced from PubChem (CID 135389521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).