C20H17ClF5N3O2 — CID 137457483
1-[2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]diazenyl]piperidin-1-yl]-2,2-difluoroethanone (PubChem CID 137457483) has the molecular formula C20H17ClF5N3O2 and a molecular weight of 461.82 g/mol. Its IUPAC name is 1-[2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]diazenyl]piperidin-1-yl]-2,2-difluoroethanone.
| Compound Name | 1-[2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]diazenyl]piperidin-1-yl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 137457483 |
| Molecular Formula | C20H17ClF5N3O2 |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 1-[2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]phenyl]diazenyl]piperidin-1-yl]-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)N1CCCCC1/N=N/c1ccc(-c2ccccc2OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H17ClF5N3O2/c21-15-11-12(27-28-17-7-3-4-10-29(17)19(30)18(22)23)8-9-13(15)14-5-1-2-6-16(14)31-20(24,25)26/h1-2,5-6,8-9,11,17-18H,3-4,7,10H2/b28-27+ |
| InChIKey | LZKCVWLGIPKYDL-BYYHNAKLSA-N |
| XLogP | 6.59 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|