C23H23ClF3N5O3 — CID 130292580
1-[(2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]oxymethyl]piperidin-1-yl]-2-(1,2,4-triazol-4-yl)ethanone (PubChem CID 130292580) has the molecular formula C23H23ClF3N5O3 and a molecular weight of 509.92 g/mol. Its IUPAC name is 1-[(2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]oxymethyl]piperidin-1-yl]-2-(1,2,4-triazol-4-yl)ethanone.
| Compound Name | 1-[(2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]oxymethyl]piperidin-1-yl]-2-(1,2,4-triazol-4-yl)ethanone |
|---|---|
| PubChem CID | 130292580 |
| Molecular Formula | C23H23ClF3N5O3 |
| Molecular Weight | 509.92 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 1-[(2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]oxymethyl]piperidin-1-yl]-2-(1,2,4-triazol-4-yl)ethanone |
| SMILES | O=C(Cn1cnnc1)N1CCCC[C@@H]1CONc1ccc(-c2ccccc2OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C23H23ClF3N5O3/c24-20-11-16(8-9-18(20)19-6-1-2-7-21(19)35-23(25,26)27)30-34-13-17-5-3-4-10-32(17)22(33)12-31-14-28-29-15-31/h1-2,6-9,11,14-15,17,30H,3-5,10,12-13H2/t17-/m1/s1 |
| InChIKey | GCEQUVRFAXXWNM-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|