C25H28ClF3N2O5 — CID 137457195
tert-butyl (2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]methoxymethyl]-4-oxopiperidine-1-carboxylate (PubChem CID 137457195) has the molecular formula C25H28ClF3N2O5 and a molecular weight of 528.96 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]methoxymethyl]-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]methoxymethyl]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 137457195 |
| Molecular Formula | C25H28ClF3N2O5 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | tert-butyl (2R)-2-[[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]methoxymethyl]-4-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C[C@@H]1COCNc1ccc(-c2ccccc2OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C25H28ClF3N2O5/c1-24(2,3)36-23(33)31-11-10-18(32)13-17(31)14-34-15-30-16-8-9-19(21(26)12-16)20-6-4-5-7-22(20)35-25(27,28)29/h4-9,12,17,30H,10-11,13-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | DLCQPMVLZIKNLC-QGZVFWFLSA-N |
| XLogP | 6.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|