C21H21ClF6N2O3 — CID 146648979
N-[5-[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]pentyl]-2-(trifluoromethoxy)acetamide (PubChem CID 146648979) has the molecular formula C21H21ClF6N2O3 and a molecular weight of 498.85 g/mol. Its IUPAC name is N-[5-[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]pentyl]-2-(trifluoromethoxy)acetamide.
| Compound Name | N-[5-[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]pentyl]-2-(trifluoromethoxy)acetamide |
|---|---|
| PubChem CID | 146648979 |
| Molecular Formula | C21H21ClF6N2O3 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-[5-[3-chloro-4-[2-(trifluoromethoxy)phenyl]anilino]pentyl]-2-(trifluoromethoxy)acetamide |
| SMILES | O=C(COC(F)(F)F)NCCCCCNc1ccc(-c2ccccc2OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClF6N2O3/c22-17-12-14(29-10-4-1-5-11-30-19(31)13-32-20(23,24)25)8-9-15(17)16-6-2-3-7-18(16)33-21(26,27)28/h2-3,6-9,12,29H,1,4-5,10-11,13H2,(H,30,31) |
| InChIKey | YHCRTKRGDIMQKI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|