C15H16Cl2O3 — CID 58954927
ethyl 1-(3,4-dichlorophenyl)-2-oxocyclohexane-1-carboxylate (PubChem CID 58954927) has the molecular formula C15H16Cl2O3 and a molecular weight of 315.20 g/mol. Its IUPAC name is ethyl 1-(3,4-dichlorophenyl)-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 1-(3,4-dichlorophenyl)-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58954927 |
| Molecular Formula | C15H16Cl2O3 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | ethyl 1-(3,4-dichlorophenyl)-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(Cl)c(Cl)c2)CCCCC1=O |
| InChI | InChI=1S/C15H16Cl2O3/c1-2-20-14(19)15(8-4-3-5-13(15)18)10-6-7-11(16)12(17)9-10/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | VUDTWTPENKPJEI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|