C18H21Cl2NO3 — CID 91327697
ethyl (1R,4S,5S)-5-(3,4-dichlorophenyl)-2,4-dimethyl-3-oxo-2-azabicyclo[3.2.1]octane-4-carboxylate (PubChem CID 91327697) has the molecular formula C18H21Cl2NO3 and a molecular weight of 370.28 g/mol. Its IUPAC name is ethyl (1R,4S,5S)-5-(3,4-dichlorophenyl)-2,4-dimethyl-3-oxo-2-azabicyclo[3.2.1]octane-4-carboxylate.
| Compound Name | ethyl (1R,4S,5S)-5-(3,4-dichlorophenyl)-2,4-dimethyl-3-oxo-2-azabicyclo[3.2.1]octane-4-carboxylate |
|---|---|
| PubChem CID | 91327697 |
| Molecular Formula | C18H21Cl2NO3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl (1R,4S,5S)-5-(3,4-dichlorophenyl)-2,4-dimethyl-3-oxo-2-azabicyclo[3.2.1]octane-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C(=O)N(C)[C@@H]2CC[C@@]1(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C18H21Cl2NO3/c1-4-24-16(23)17(2)15(22)21(3)12-7-8-18(17,10-12)11-5-6-13(19)14(20)9-11/h5-6,9,12H,4,7-8,10H2,1-3H3/t12-,17+,18+/m1/s1 |
| InChIKey | UOQKJZJUWSDLMJ-UUWFMWQGSA-N |
| XLogP | 3.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|