About ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate
ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 154170184) has the molecular formula C16H21Cl2NO3
and a molecular weight of 346.25 g/mol. Its IUPAC name is ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate |
| PubChem CID | 154170184 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC(O)(c2ccc(Cl)c(Cl)c2)CC1C(C)C |
| InChI | InChI=1S/C16H21Cl2NO3/c1-4-22-15(20)19-9-16(21,8-14(19)10(2)3)11-5-6-12(17)13(18)7-11/h5-7,10,14,21H,4,8-9H2,1-3H3 |
| InChIKey | AAVXQWXPOKTKMC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate?
The IUPAC name of ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate (CID 154170184) is ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate.
What is the SMILES notation for ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate?
The canonical SMILES for ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate is CCOC(=O)N1CC(O)(c2ccc(Cl)c(Cl)c2)CC1C(C)C.
What is the InChIKey of ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate?
The InChIKey is AAVXQWXPOKTKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2NO3/c1-4-22-15(20)19-9-16(21,8-14(19)10(2)3)11-5-6-12(17)13(18)7-11/h5-7,10,14,21H,4,8-9H2,1-3H3.
What are the key properties of ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate?
ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate has a molecular weight of 346.25 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,4-dichlorophenyl)-4-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate is sourced from PubChem (CID 154170184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).