C11H8ClF3O5 — CID 69046821
2-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]propanedioic acid (PubChem CID 69046821) has the molecular formula C11H8ClF3O5 and a molecular weight of 312.63 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 69046821 |
| Molecular Formula | C11H8ClF3O5 |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]propanedioic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)c(OC(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C11H8ClF3O5/c12-7-2-1-5(3-6(9(16)17)10(18)19)4-8(7)20-11(13,14)15/h1-2,4,6H,3H2,(H,16,17)(H,18,19) |
| InChIKey | RRACPIZLTNNWDN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|