C12H12ClF3O3 — CID 134632674
ethyl 3-[4-chloro-3-(trifluoromethoxy)phenyl]propanoate (PubChem CID 134632674) has the molecular formula C12H12ClF3O3 and a molecular weight of 296.67 g/mol. Its IUPAC name is ethyl 3-[4-chloro-3-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | ethyl 3-[4-chloro-3-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 134632674 |
| Molecular Formula | C12H12ClF3O3 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | ethyl 3-[4-chloro-3-(trifluoromethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(Cl)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3O3/c1-2-18-11(17)6-4-8-3-5-9(13)10(7-8)19-12(14,15)16/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | KPSGAFJLKSAYLI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |