C13H14ClF3N2O3 — CID 66720697
[4-chloro-3-(trifluoromethoxy)phenyl]methyl piperazine-1-carboxylate (PubChem CID 66720697) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is [4-chloro-3-(trifluoromethoxy)phenyl]methyl piperazine-1-carboxylate.
| Compound Name | [4-chloro-3-(trifluoromethoxy)phenyl]methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66720697 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [4-chloro-3-(trifluoromethoxy)phenyl]methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c(OC(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H14ClF3N2O3/c14-10-2-1-9(7-11(10)22-13(15,16)17)8-21-12(20)19-5-3-18-4-6-19/h1-2,7,18H,3-6,8H2 |
| InChIKey | IKIXIUBIWDNLGY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |