C18H21ClF3NO4 — CID 139573486
tert-butyl N-[1-[3-chloro-5-(trifluoromethoxy)phenyl]-2-oxocyclohexyl]carbamate (PubChem CID 139573486) has the molecular formula C18H21ClF3NO4 and a molecular weight of 407.82 g/mol. Its IUPAC name is tert-butyl N-[1-[3-chloro-5-(trifluoromethoxy)phenyl]-2-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-chloro-5-(trifluoromethoxy)phenyl]-2-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 139573486 |
| Molecular Formula | C18H21ClF3NO4 |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | tert-butyl N-[1-[3-chloro-5-(trifluoromethoxy)phenyl]-2-oxocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cc(Cl)cc(OC(F)(F)F)c2)CCCCC1=O |
| InChI | InChI=1S/C18H21ClF3NO4/c1-16(2,3)27-15(25)23-17(7-5-4-6-14(17)24)11-8-12(19)10-13(9-11)26-18(20,21)22/h8-10H,4-7H2,1-3H3,(H,23,25) |
| InChIKey | UQPFQRASGLCOOR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |