C18H22N2O3 — CID 169100257
tert-butyl N-[(1R)-1-(3-cyanophenyl)-2-oxocyclohexyl]carbamate (PubChem CID 169100257) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(3-cyanophenyl)-2-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(3-cyanophenyl)-2-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 169100257 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | tert-butyl N-[(1R)-1-(3-cyanophenyl)-2-oxocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(c2cccc(C#N)c2)CCCCC1=O |
| InChI | InChI=1S/C18H22N2O3/c1-17(2,3)23-16(22)20-18(10-5-4-9-15(18)21)14-8-6-7-13(11-14)12-19/h6-8,11H,4-5,9-10H2,1-3H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | YFOMMIOOSMLAGE-GOSISDBHSA-N |
| XLogP | 3.42 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |